C17H23NO3 — CID 105030066
N-[1-(2,5-dimethoxyphenyl)-2-(furan-3-yl)ethyl]propan-1-amine (PubChem CID 105030066) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[1-(2,5-dimethoxyphenyl)-2-(furan-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(2,5-dimethoxyphenyl)-2-(furan-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105030066 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-[1-(2,5-dimethoxyphenyl)-2-(furan-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccoc1)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C17H23NO3/c1-4-8-18-16(10-13-7-9-21-12-13)15-11-14(19-2)5-6-17(15)20-3/h5-7,9,11-12,16,18H,4,8,10H2,1-3H3 |
| InChIKey | NHPXCRKQTLQGNF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |