C14H18N2O3 — CID 105331682
[1-(2,5-dimethoxyphenyl)-2-(furan-3-yl)ethyl]hydrazine (PubChem CID 105331682) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is [1-(2,5-dimethoxyphenyl)-2-(furan-3-yl)ethyl]hydrazine.
| Compound Name | [1-(2,5-dimethoxyphenyl)-2-(furan-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105331682 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | [1-(2,5-dimethoxyphenyl)-2-(furan-3-yl)ethyl]hydrazine |
| SMILES | COc1ccc(OC)c(C(Cc2ccoc2)NN)c1 |
| InChI | InChI=1S/C14H18N2O3/c1-17-11-3-4-14(18-2)12(8-11)13(16-15)7-10-5-6-19-9-10/h3-6,8-9,13,16H,7,15H2,1-2H3 |
| InChIKey | RDFAWRJXQRACIM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 69.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|