C13H22N2O2S — CID 105225815
[1-(2,5-dimethoxyphenyl)-2-propylsulfanylethyl]hydrazine (PubChem CID 105225815) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is [1-(2,5-dimethoxyphenyl)-2-propylsulfanylethyl]hydrazine.
| Compound Name | [1-(2,5-dimethoxyphenyl)-2-propylsulfanylethyl]hydrazine |
|---|---|
| PubChem CID | 105225815 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | [1-(2,5-dimethoxyphenyl)-2-propylsulfanylethyl]hydrazine |
| SMILES | CCCSCC(NN)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H22N2O2S/c1-4-7-18-9-12(15-14)11-8-10(16-2)5-6-13(11)17-3/h5-6,8,12,15H,4,7,9,14H2,1-3H3 |
| InChIKey | FHRAZZQYJOHULE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|