C12H11ClF2N2S — CID 105030456
1-(4-chloro-2,5-difluorophenyl)-N-methyl-2-(1,3-thiazol-5-yl)ethanamine (PubChem CID 105030456) has the molecular formula C12H11ClF2N2S and a molecular weight of 288.75 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-N-methyl-2-(1,3-thiazol-5-yl)ethanamine.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-N-methyl-2-(1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 105030456 |
| Molecular Formula | C12H11ClF2N2S |
| Molecular Weight | 288.75 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-N-methyl-2-(1,3-thiazol-5-yl)ethanamine |
| SMILES | CNC(Cc1cncs1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C12H11ClF2N2S/c1-16-12(2-7-5-17-6-18-7)8-3-11(15)9(13)4-10(8)14/h3-6,12,16H,2H2,1H3 |
| InChIKey | VXECWVOTADSMKO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.75 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|