C23H40BrFSi — CID 10503419
[(2Z,6Z,10E,14E)-17-bromo-7-fluoro-6,11,15-trimethylheptadeca-2,6,10,14-tetraenyl]-trimethylsilane (PubChem CID 10503419) has the molecular formula C23H40BrFSi and a molecular weight of 443.56 g/mol. Its IUPAC name is [(2Z,6Z,10E,14E)-17-bromo-7-fluoro-6,11,15-trimethylheptadeca-2,6,10,14-tetraenyl]-trimethylsilane.
| Compound Name | [(2Z,6Z,10E,14E)-17-bromo-7-fluoro-6,11,15-trimethylheptadeca-2,6,10,14-tetraenyl]-trimethylsilane |
|---|---|
| PubChem CID | 10503419 |
| Molecular Formula | C23H40BrFSi |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [(2Z,6Z,10E,14E)-17-bromo-7-fluoro-6,11,15-trimethylheptadeca-2,6,10,14-tetraenyl]-trimethylsilane |
| SMILES | C/C(CC/C=C\C[Si](C)(C)C)=C(/F)CC/C=C(\C)CC/C=C(\C)CCBr |
| InChI | InChI=1S/C23H40BrFSi/c1-20(12-10-13-21(2)17-18-24)14-11-16-23(25)22(3)15-8-7-9-19-26(4,5)6/h7,9,13-14H,8,10-12,15-19H2,1-6H3/b9-7-,20-14+,21-13+,23-22- |
| InChIKey | WGYVRKPVEQGIIX-AAMXRDCXSA-N |
| XLogP | 9.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|