C18H33FSi — CID 10661669
[(2Z,6Z,10E)-7-fluoro-6,11-dimethyltrideca-2,6,10-trienyl]-trimethylsilane (PubChem CID 10661669) has the molecular formula C18H33FSi and a molecular weight of 296.55 g/mol. Its IUPAC name is [(2Z,6Z,10E)-7-fluoro-6,11-dimethyltrideca-2,6,10-trienyl]-trimethylsilane.
| Compound Name | [(2Z,6Z,10E)-7-fluoro-6,11-dimethyltrideca-2,6,10-trienyl]-trimethylsilane |
|---|---|
| PubChem CID | 10661669 |
| Molecular Formula | C18H33FSi |
| Molecular Weight | 296.55 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | [(2Z,6Z,10E)-7-fluoro-6,11-dimethyltrideca-2,6,10-trienyl]-trimethylsilane |
| SMILES | CC/C(C)=C/CC/C(F)=C(\C)CC/C=C\C[Si](C)(C)C |
| InChI | InChI=1S/C18H33FSi/c1-7-16(2)12-11-14-18(19)17(3)13-9-8-10-15-20(4,5)6/h8,10,12H,7,9,11,13-15H2,1-6H3/b10-8-,16-12+,18-17- |
| InChIKey | JPWPLLIKDHSIQA-QHUTUJQRSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.55 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|