C18H32BrFSi — CID 10667182
[(2Z,6Z,10E)-13-bromo-7-fluoro-6,11-dimethyltrideca-2,6,10-trienyl]-trimethylsilane (PubChem CID 10667182) has the molecular formula C18H32BrFSi and a molecular weight of 375.44 g/mol. Its IUPAC name is [(2Z,6Z,10E)-13-bromo-7-fluoro-6,11-dimethyltrideca-2,6,10-trienyl]-trimethylsilane.
| Compound Name | [(2Z,6Z,10E)-13-bromo-7-fluoro-6,11-dimethyltrideca-2,6,10-trienyl]-trimethylsilane |
|---|---|
| PubChem CID | 10667182 |
| Molecular Formula | C18H32BrFSi |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | [(2Z,6Z,10E)-13-bromo-7-fluoro-6,11-dimethyltrideca-2,6,10-trienyl]-trimethylsilane |
| SMILES | C/C(CC/C=C\C[Si](C)(C)C)=C(/F)CC/C=C(\C)CCBr |
| InChI | InChI=1S/C18H32BrFSi/c1-16(13-14-19)10-9-12-18(20)17(2)11-7-6-8-15-21(3,4)5/h6,8,10H,7,9,11-15H2,1-5H3/b8-6-,16-10+,18-17- |
| InChIKey | ROVYFPVTECGYML-DHQJAINDSA-N |
| XLogP | 7.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|