C18H29BrClN — CID 105037738
1-(4-bromo-2-chlorophenyl)-3-ethyl-N-propylheptan-2-amine (PubChem CID 105037738) has the molecular formula C18H29BrClN and a molecular weight of 374.79 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-ethyl-N-propylheptan-2-amine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-ethyl-N-propylheptan-2-amine |
|---|---|
| PubChem CID | 105037738 |
| Molecular Formula | C18H29BrClN |
| Molecular Weight | 374.79 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-ethyl-N-propylheptan-2-amine |
| SMILES | CCCCC(CC)C(Cc1ccc(Br)cc1Cl)NCCC |
| InChI | InChI=1S/C18H29BrClN/c1-4-7-8-14(6-3)18(21-11-5-2)12-15-9-10-16(19)13-17(15)20/h9-10,13-14,18,21H,4-8,11-12H2,1-3H3 |
| InChIKey | ZNRNJIPSRNXOGX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.79 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |