About (E)-N-diphenylphosphoryl-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-imine
(E)-N-diphenylphosphoryl-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-imine (PubChem CID 10503852) has the molecular formula C28H24NO3P
and a molecular weight of 453.48 g/mol. Its IUPAC name is (E)-N-diphenylphosphoryl-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-imine.
Molecular Properties
| Compound Name | (E)-N-diphenylphosphoryl-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-imine |
| PubChem CID | 10503852 |
| Molecular Formula | C28H24NO3P |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | (E)-N-diphenylphosphoryl-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-imine |
| SMILES | COc1ccc(C2COc3ccccc3/C2=N/P(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24NO3P/c1-31-22-18-16-21(17-19-22)26-20-32-27-15-9-8-14-25(27)28(26)29-33(30,23-10-4-2-5-11-23)24-12-6-3-7-13-24/h2-19,26H,20H2,1H3/b29-28- |
| InChIKey | KIJJZKAWUBIEDG-ZIADKAODSA-N |
| XLogP | 5.59 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-diphenylphosphoryl-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-diphenylphosphoryl-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-imine?
The IUPAC name of (E)-N-diphenylphosphoryl-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-imine (CID 10503852) is (E)-N-diphenylphosphoryl-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-imine.
What is the SMILES notation for (E)-N-diphenylphosphoryl-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-imine?
The canonical SMILES for (E)-N-diphenylphosphoryl-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-imine is COc1ccc(C2COc3ccccc3/C2=N/P(=O)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (E)-N-diphenylphosphoryl-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-imine?
The InChIKey is KIJJZKAWUBIEDG-ZIADKAODSA-N. The full InChI is InChI=1S/C28H24NO3P/c1-31-22-18-16-21(17-19-22)26-20-32-27-15-9-8-14-25(27)28(26)29-33(30,23-10-4-2-5-11-23)24-12-6-3-7-13-24/h2-19,26H,20H2,1H3/b29-28-.
What are the key properties of (E)-N-diphenylphosphoryl-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-imine?
(E)-N-diphenylphosphoryl-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-imine has a molecular weight of 453.48 g/mol, XLogP of 5.59, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-diphenylphosphoryl-3-(4-methoxyphenyl)-2,3-dihydrochromen-4-imine is sourced from PubChem (CID 10503852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).