C29H26NO2P — CID 10599690
(E)-N-diphenylphosphoryl-2-(3-methoxyphenyl)-3,4-dihydro-2H-naphthalen-1-imine (PubChem CID 10599690) has the molecular formula C29H26NO2P and a molecular weight of 451.51 g/mol. Its IUPAC name is (E)-N-diphenylphosphoryl-2-(3-methoxyphenyl)-3,4-dihydro-2H-naphthalen-1-imine.
| Compound Name | (E)-N-diphenylphosphoryl-2-(3-methoxyphenyl)-3,4-dihydro-2H-naphthalen-1-imine |
|---|---|
| PubChem CID | 10599690 |
| Molecular Formula | C29H26NO2P |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | (E)-N-diphenylphosphoryl-2-(3-methoxyphenyl)-3,4-dihydro-2H-naphthalen-1-imine |
| SMILES | COc1cccc(C2CCc3ccccc3/C2=N/P(=O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C29H26NO2P/c1-32-24-13-10-12-23(21-24)28-20-19-22-11-8-9-18-27(22)29(28)30-33(31,25-14-4-2-5-15-25)26-16-6-3-7-17-26/h2-18,21,28H,19-20H2,1H3/b30-29- |
| InChIKey | GLFONOMNSVUEPV-FLWNBWAVSA-N |
| XLogP | 6.14 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|