C17H14N2O3 — CID 13275798
2-[2-(3-methoxyphenyl)aziridin-1-yl]isoindole-1,3-dione (PubChem CID 13275798) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[2-(3-methoxyphenyl)aziridin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-(3-methoxyphenyl)aziridin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 13275798 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[2-(3-methoxyphenyl)aziridin-1-yl]isoindole-1,3-dione |
| SMILES | COc1cccc(C2CN2N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C17H14N2O3/c1-22-12-6-4-5-11(9-12)15-10-18(15)19-16(20)13-7-2-3-8-14(13)17(19)21/h2-9,15H,10H2,1H3 |
| InChIKey | OUGOKSNXNCUWCE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|