C9H16ClN3O2S — CID 105041731
1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-methylsulfonylethanamine (PubChem CID 105041731) has the molecular formula C9H16ClN3O2S and a molecular weight of 265.77 g/mol. Its IUPAC name is 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-methylsulfonylethanamine.
| Compound Name | 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-methylsulfonylethanamine |
|---|---|
| PubChem CID | 105041731 |
| Molecular Formula | C9H16ClN3O2S |
| Molecular Weight | 265.77 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-methylsulfonylethanamine |
| SMILES | CC(C)n1ncc(Cl)c1C(N)CS(C)(=O)=O |
| InChI | InChI=1S/C9H16ClN3O2S/c1-6(2)13-9(7(10)4-12-13)8(11)5-16(3,14)15/h4,6,8H,5,11H2,1-3H3 |
| InChIKey | VHJUFNBCZDMNOZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.77 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |