C15H24ClN3 — CID 105041938
2-(2-bicyclo[2.2.1]heptanyl)-1-(4-chloro-1-propan-2-ylpyrazol-5-yl)ethanamine (PubChem CID 105041938) has the molecular formula C15H24ClN3 and a molecular weight of 281.83 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-chloro-1-propan-2-ylpyrazol-5-yl)ethanamine.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-chloro-1-propan-2-ylpyrazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 105041938 |
| Molecular Formula | C15H24ClN3 |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-chloro-1-propan-2-ylpyrazol-5-yl)ethanamine |
| SMILES | CC(C)n1ncc(Cl)c1C(N)CC1CC2CCC1C2 |
| InChI | InChI=1S/C15H24ClN3/c1-9(2)19-15(13(16)8-18-19)14(17)7-12-6-10-3-4-11(12)5-10/h8-12,14H,3-7,17H2,1-2H3 |
| InChIKey | BYELGOTXRCNZSO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |