C14H22ClN3 — CID 105041966
7-bicyclo[4.1.0]heptanyl-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanamine (PubChem CID 105041966) has the molecular formula C14H22ClN3 and a molecular weight of 267.80 g/mol. Its IUPAC name is 7-bicyclo[4.1.0]heptanyl-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanamine.
| Compound Name | 7-bicyclo[4.1.0]heptanyl-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanamine |
|---|---|
| PubChem CID | 105041966 |
| Molecular Formula | C14H22ClN3 |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 7-bicyclo[4.1.0]heptanyl-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanamine |
| SMILES | CC(C)n1ncc(Cl)c1C(N)C1C2CCCCC21 |
| InChI | InChI=1S/C14H22ClN3/c1-8(2)18-14(11(15)7-17-18)13(16)12-9-5-3-4-6-10(9)12/h7-10,12-13H,3-6,16H2,1-2H3 |
| InChIKey | XFWJVPYRCOONJF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |