C13H23ClN4 — CID 105201958
[(4-chloro-1-propan-2-ylpyrazol-5-yl)-cyclohexylmethyl]hydrazine (PubChem CID 105201958) has the molecular formula C13H23ClN4 and a molecular weight of 270.81 g/mol. Its IUPAC name is [(4-chloro-1-propan-2-ylpyrazol-5-yl)-cyclohexylmethyl]hydrazine.
| Compound Name | [(4-chloro-1-propan-2-ylpyrazol-5-yl)-cyclohexylmethyl]hydrazine |
|---|---|
| PubChem CID | 105201958 |
| Molecular Formula | C13H23ClN4 |
| Molecular Weight | 270.81 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | [(4-chloro-1-propan-2-ylpyrazol-5-yl)-cyclohexylmethyl]hydrazine |
| SMILES | CC(C)n1ncc(Cl)c1C(NN)C1CCCCC1 |
| InChI | InChI=1S/C13H23ClN4/c1-9(2)18-13(11(14)8-16-18)12(17-15)10-6-4-3-5-7-10/h8-10,12,17H,3-7,15H2,1-2H3 |
| InChIKey | ZJQDBKYVVBRREG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.81 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|