C14H24ClN5O — CID 105245184
[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(4-chloro-1-propan-2-ylpyrazol-5-yl)methyl]hydrazine (PubChem CID 105245184) has the molecular formula C14H24ClN5O and a molecular weight of 313.83 g/mol. Its IUPAC name is [3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(4-chloro-1-propan-2-ylpyrazol-5-yl)methyl]hydrazine.
| Compound Name | [3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(4-chloro-1-propan-2-ylpyrazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105245184 |
| Molecular Formula | C14H24ClN5O |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | [3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(4-chloro-1-propan-2-ylpyrazol-5-yl)methyl]hydrazine |
| SMILES | CC(C)n1ncc(Cl)c1C(NN)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C14H24ClN5O/c1-9(2)20-14(11(15)6-17-20)13(18-16)12-7-19-5-3-4-10(19)8-21-12/h6,9-10,12-13,18H,3-5,7-8,16H2,1-2H3 |
| InChIKey | LALLKDJNJVLHCR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|