C17H30ClN3 — CID 114655573
(4-tert-butylcyclohexyl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanamine (PubChem CID 114655573) has the molecular formula C17H30ClN3 and a molecular weight of 311.90 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanamine.
| Compound Name | (4-tert-butylcyclohexyl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanamine |
|---|---|
| PubChem CID | 114655573 |
| Molecular Formula | C17H30ClN3 |
| Molecular Weight | 311.90 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | (4-tert-butylcyclohexyl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanamine |
| SMILES | CC(C)n1ncc(Cl)c1C(N)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H30ClN3/c1-11(2)21-16(14(18)10-20-21)15(19)12-6-8-13(9-7-12)17(3,4)5/h10-13,15H,6-9,19H2,1-5H3 |
| InChIKey | ZVZWZOUKBZVZCF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |