C12H16ClN3S — CID 105183708
1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-thiophen-3-ylethanamine (PubChem CID 105183708) has the molecular formula C12H16ClN3S and a molecular weight of 269.80 g/mol. Its IUPAC name is 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-thiophen-3-ylethanamine.
| Compound Name | 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 105183708 |
| Molecular Formula | C12H16ClN3S |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-thiophen-3-ylethanamine |
| SMILES | CC(C)n1ncc(Cl)c1C(N)Cc1ccsc1 |
| InChI | InChI=1S/C12H16ClN3S/c1-8(2)16-12(10(13)6-15-16)11(14)5-9-3-4-17-7-9/h3-4,6-8,11H,5,14H2,1-2H3 |
| InChIKey | FRQUIERDSNUFJC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |