C26H49N3O5 — CID 10505012
tert-butyl N-[3-[bis(prop-2-enyl)amino]propyl]-N-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]butyl]carbamate (PubChem CID 10505012) has the molecular formula C26H49N3O5 and a molecular weight of 483.69 g/mol. Its IUPAC name is tert-butyl N-[3-[bis(prop-2-enyl)amino]propyl]-N-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]butyl]carbamate.
| Compound Name | tert-butyl N-[3-[bis(prop-2-enyl)amino]propyl]-N-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]butyl]carbamate |
|---|---|
| PubChem CID | 10505012 |
| Molecular Formula | C26H49N3O5 |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.37 |
| IUPAC Name | tert-butyl N-[3-[bis(prop-2-enyl)amino]propyl]-N-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]butyl]carbamate |
| SMILES | C=CCN(CC=C)CCCN(CCCCOCCCNC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H49N3O5/c1-9-16-28(17-10-2)18-14-20-29(24(31)34-26(6,7)8)19-11-12-21-32-22-13-15-27-23(30)33-25(3,4)5/h9-10H,1-2,11-22H2,3-8H3,(H,27,30) |
| InChIKey | BMQBJNADVKGJGH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|