C19H31N — CID 105052388
1-(2-cyclobutylphenyl)-N,3,4,4-tetramethylpentan-1-amine (PubChem CID 105052388) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 1-(2-cyclobutylphenyl)-N,3,4,4-tetramethylpentan-1-amine.
| Compound Name | 1-(2-cyclobutylphenyl)-N,3,4,4-tetramethylpentan-1-amine |
|---|---|
| PubChem CID | 105052388 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 1-(2-cyclobutylphenyl)-N,3,4,4-tetramethylpentan-1-amine |
| SMILES | CNC(CC(C)C(C)(C)C)c1ccccc1C1CCC1 |
| InChI | InChI=1S/C19H31N/c1-14(19(2,3)4)13-18(20-5)17-12-7-6-11-16(17)15-9-8-10-15/h6-7,11-12,14-15,18,20H,8-10,13H2,1-5H3 |
| InChIKey | QNSNMKWJELLDPG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |