C20H25N — CID 114602810
1-(2-cyclobutylphenyl)-N-methyl-2-(2-methylphenyl)ethanamine (PubChem CID 114602810) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is 1-(2-cyclobutylphenyl)-N-methyl-2-(2-methylphenyl)ethanamine.
| Compound Name | 1-(2-cyclobutylphenyl)-N-methyl-2-(2-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 114602810 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 1-(2-cyclobutylphenyl)-N-methyl-2-(2-methylphenyl)ethanamine |
| SMILES | CNC(Cc1ccccc1C)c1ccccc1C1CCC1 |
| InChI | InChI=1S/C20H25N/c1-15-8-3-4-9-17(15)14-20(21-2)19-13-6-5-12-18(19)16-10-7-11-16/h3-6,8-9,12-13,16,20-21H,7,10-11,14H2,1-2H3 |
| InChIKey | HXKTWUZQKBWYCL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |