C17H29N — CID 115850527
1-(2,3-dimethylphenyl)-N,3,4,4-tetramethylpentan-1-amine (PubChem CID 115850527) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-N,3,4,4-tetramethylpentan-1-amine.
| Compound Name | 1-(2,3-dimethylphenyl)-N,3,4,4-tetramethylpentan-1-amine |
|---|---|
| PubChem CID | 115850527 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-N,3,4,4-tetramethylpentan-1-amine |
| SMILES | CNC(CC(C)C(C)(C)C)c1cccc(C)c1C |
| InChI | InChI=1S/C17H29N/c1-12-9-8-10-15(14(12)3)16(18-7)11-13(2)17(4,5)6/h8-10,13,16,18H,11H2,1-7H3 |
| InChIKey | ZNADMQXDEPAWHZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |