C17H16BrF2N — CID 105052438
(4-bromo-2,6-difluorophenyl)-(2-cyclobutylphenyl)methanamine (PubChem CID 105052438) has the molecular formula C17H16BrF2N and a molecular weight of 352.22 g/mol. Its IUPAC name is (4-bromo-2,6-difluorophenyl)-(2-cyclobutylphenyl)methanamine.
| Compound Name | (4-bromo-2,6-difluorophenyl)-(2-cyclobutylphenyl)methanamine |
|---|---|
| PubChem CID | 105052438 |
| Molecular Formula | C17H16BrF2N |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | (4-bromo-2,6-difluorophenyl)-(2-cyclobutylphenyl)methanamine |
| SMILES | NC(c1ccccc1C1CCC1)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C17H16BrF2N/c18-11-8-14(19)16(15(20)9-11)17(21)13-7-2-1-6-12(13)10-4-3-5-10/h1-2,6-10,17H,3-5,21H2 |
| InChIKey | SEEGMNCGFNIIRT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |