C17H17Br2N — CID 107946938
(2-cyclobutylphenyl)-(2,4-dibromophenyl)methanamine (PubChem CID 107946938) has the molecular formula C17H17Br2N and a molecular weight of 395.14 g/mol. Its IUPAC name is (2-cyclobutylphenyl)-(2,4-dibromophenyl)methanamine.
| Compound Name | (2-cyclobutylphenyl)-(2,4-dibromophenyl)methanamine |
|---|---|
| PubChem CID | 107946938 |
| Molecular Formula | C17H17Br2N |
| Molecular Weight | 395.14 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | (2-cyclobutylphenyl)-(2,4-dibromophenyl)methanamine |
| SMILES | NC(c1ccc(Br)cc1Br)c1ccccc1C1CCC1 |
| InChI | InChI=1S/C17H17Br2N/c18-12-8-9-15(16(19)10-12)17(20)14-7-2-1-6-13(14)11-4-3-5-11/h1-2,6-11,17H,3-5,20H2 |
| InChIKey | AETPTCSIPQKADY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.14 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |