C16H19NS — CID 114604077
(2-cyclobutylphenyl)-(4-methylthiophen-3-yl)methanamine (PubChem CID 114604077) has the molecular formula C16H19NS and a molecular weight of 257.40 g/mol. Its IUPAC name is (2-cyclobutylphenyl)-(4-methylthiophen-3-yl)methanamine.
| Compound Name | (2-cyclobutylphenyl)-(4-methylthiophen-3-yl)methanamine |
|---|---|
| PubChem CID | 114604077 |
| Molecular Formula | C16H19NS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (2-cyclobutylphenyl)-(4-methylthiophen-3-yl)methanamine |
| SMILES | Cc1cscc1C(N)c1ccccc1C1CCC1 |
| InChI | InChI=1S/C16H19NS/c1-11-9-18-10-15(11)16(17)14-8-3-2-7-13(14)12-5-4-6-12/h2-3,7-10,12,16H,4-6,17H2,1H3 |
| InChIKey | IOTQELJIBNKMRC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |