C14H16N2S — CID 114604148
(2-cyclobutylphenyl)-(1,3-thiazol-4-yl)methanamine (PubChem CID 114604148) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is (2-cyclobutylphenyl)-(1,3-thiazol-4-yl)methanamine.
| Compound Name | (2-cyclobutylphenyl)-(1,3-thiazol-4-yl)methanamine |
|---|---|
| PubChem CID | 114604148 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | (2-cyclobutylphenyl)-(1,3-thiazol-4-yl)methanamine |
| SMILES | NC(c1cscn1)c1ccccc1C1CCC1 |
| InChI | InChI=1S/C14H16N2S/c15-14(13-8-17-9-16-13)12-7-2-1-6-11(12)10-4-3-5-10/h1-2,6-10,14H,3-5,15H2 |
| InChIKey | LWIDAYBNRPTYIN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |