C14H14BrClO3S — CID 105057182
2-[(4-bromo-2,5-dimethoxyphenyl)-chloromethyl]-4-methoxythiophene (PubChem CID 105057182) has the molecular formula C14H14BrClO3S and a molecular weight of 377.69 g/mol. Its IUPAC name is 2-[(4-bromo-2,5-dimethoxyphenyl)-chloromethyl]-4-methoxythiophene.
| Compound Name | 2-[(4-bromo-2,5-dimethoxyphenyl)-chloromethyl]-4-methoxythiophene |
|---|---|
| PubChem CID | 105057182 |
| Molecular Formula | C14H14BrClO3S |
| Molecular Weight | 377.69 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 2-[(4-bromo-2,5-dimethoxyphenyl)-chloromethyl]-4-methoxythiophene |
| SMILES | COc1csc(C(Cl)c2cc(OC)c(Br)cc2OC)c1 |
| InChI | InChI=1S/C14H14BrClO3S/c1-17-8-4-13(20-7-8)14(16)9-5-12(19-3)10(15)6-11(9)18-2/h4-7,14H,1-3H3 |
| InChIKey | JKDBNRWKDDGRKG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.69 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|