C22H33IN2O6 — CID 10506813
2-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)-N-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]acetamide iodide (PubChem CID 10506813) has the molecular formula C22H33IN2O6 and a molecular weight of 548.42 g/mol. Its IUPAC name is 2-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)-N-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]acetamide iodide.
| Compound Name | 2-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)-N-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]acetamide iodide |
|---|---|
| PubChem CID | 10506813 |
| Molecular Formula | C22H33IN2O6 |
| Molecular Weight | 548.42 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 2-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)-N-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]acetamide iodide |
| SMILES | CC[N+]1=C(C)C(C)(C)c2cc(CC(=O)NC[C@H]3O[C@H](OC)[C@H](O)[C@@H](O)[C@@H]3O)ccc21.[I-] |
| InChI | InChI=1S/C22H32N2O6.HI/c1-6-24-12(2)22(3,4)14-9-13(7-8-15(14)24)10-17(25)23-11-16-18(26)19(27)20(28)21(29-5)30-16;/h7-9,16,18-21,26-28H,6,10-11H2,1-5H3;1H/t16-,18-,19+,20-,21+;/m1./s1 |
| InChIKey | AXASTWNHWCCIMA-ICVQRMELSA-N |
| XLogP | -2.78 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.42 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|