C14H18N4O3 — CID 105070552
4-[3-(ethylamino)pyridine-4-carbonyl]-3,3-dimethylpiperazine-2,6-dione (PubChem CID 105070552) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-[3-(ethylamino)pyridine-4-carbonyl]-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-[3-(ethylamino)pyridine-4-carbonyl]-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 105070552 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 4-[3-(ethylamino)pyridine-4-carbonyl]-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CCNc1cnccc1C(=O)N1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C14H18N4O3/c1-4-16-10-7-15-6-5-9(10)12(20)18-8-11(19)17-13(21)14(18,2)3/h5-7,16H,4,8H2,1-3H3,(H,17,19,21) |
| InChIKey | SOLGXNPKFCJXIL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|