C34H51NO5Si — CID 10507491
(4R)-4-benzhydryl-3-[(2R)-2-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-7-methyloctanoyl]-1,3-oxazolidin-2-one (PubChem CID 10507491) has the molecular formula C34H51NO5Si and a molecular weight of 581.87 g/mol. Its IUPAC name is (4R)-4-benzhydryl-3-[(2R)-2-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-7-methyloctanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzhydryl-3-[(2R)-2-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-7-methyloctanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10507491 |
| Molecular Formula | C34H51NO5Si |
| Molecular Weight | 581.87 g/mol |
| Exact Mass | 581.35 |
| IUPAC Name | (4R)-4-benzhydryl-3-[(2R)-2-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-7-methyloctanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)CCCC[C@@H](C(=O)N1C(=O)OC[C@H]1C(c1ccccc1)c1ccccc1)[C@@H](O)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H51NO5Si/c1-24(2)17-15-16-22-28(31(36)25(3)40-41(7,8)34(4,5)6)32(37)35-29(23-39-33(35)38)30(26-18-11-9-12-19-26)27-20-13-10-14-21-27/h9-14,18-21,24-25,28-31,36H,15-17,22-23H2,1-8H3/t25-,28-,29+,31+/m1/s1 |
| InChIKey | YHVQNXQWYDBWMV-WODIESPSSA-N |
| XLogP | 7.77 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.87 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|