C14H14N2OS2 — CID 105083304
2-(1-benzothiophen-3-yl)-1-(4-ethylthiadiazol-5-yl)ethanol (PubChem CID 105083304) has the molecular formula C14H14N2OS2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-1-(4-ethylthiadiazol-5-yl)ethanol.
| Compound Name | 2-(1-benzothiophen-3-yl)-1-(4-ethylthiadiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 105083304 |
| Molecular Formula | C14H14N2OS2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-1-(4-ethylthiadiazol-5-yl)ethanol |
| SMILES | CCc1nnsc1C(O)Cc1csc2ccccc12 |
| InChI | InChI=1S/C14H14N2OS2/c1-2-11-14(19-16-15-11)12(17)7-9-8-18-13-6-4-3-5-10(9)13/h3-6,8,12,17H,2,7H2,1H3 |
| InChIKey | RVBHJKPGGUSSOS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |