C16H18N2OS2 — CID 105083332
2-(1-benzothiophen-3-yl)-1-(4-tert-butylthiadiazol-5-yl)ethanol (PubChem CID 105083332) has the molecular formula C16H18N2OS2 and a molecular weight of 318.47 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-1-(4-tert-butylthiadiazol-5-yl)ethanol.
| Compound Name | 2-(1-benzothiophen-3-yl)-1-(4-tert-butylthiadiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 105083332 |
| Molecular Formula | C16H18N2OS2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-1-(4-tert-butylthiadiazol-5-yl)ethanol |
| SMILES | CC(C)(C)c1nnsc1C(O)Cc1csc2ccccc12 |
| InChI | InChI=1S/C16H18N2OS2/c1-16(2,3)15-14(21-18-17-15)12(19)8-10-9-20-13-7-5-4-6-11(10)13/h4-7,9,12,19H,8H2,1-3H3 |
| InChIKey | ZSZLJPZWQVOBSW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |