C15H16N2OS2 — CID 105083334
2-(1-benzothiophen-3-yl)-1-(4-propylthiadiazol-5-yl)ethanol (PubChem CID 105083334) has the molecular formula C15H16N2OS2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-1-(4-propylthiadiazol-5-yl)ethanol.
| Compound Name | 2-(1-benzothiophen-3-yl)-1-(4-propylthiadiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 105083334 |
| Molecular Formula | C15H16N2OS2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-1-(4-propylthiadiazol-5-yl)ethanol |
| SMILES | CCCc1nnsc1C(O)Cc1csc2ccccc12 |
| InChI | InChI=1S/C15H16N2OS2/c1-2-5-12-15(20-17-16-12)13(18)8-10-9-19-14-7-4-3-6-11(10)14/h3-4,6-7,9,13,18H,2,5,8H2,1H3 |
| InChIKey | MDOHMSVFURPLTK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |