C16H12Cl2N2O — CID 105086789
2-(2,4-dichlorophenyl)-1-quinoxalin-5-ylethanol (PubChem CID 105086789) has the molecular formula C16H12Cl2N2O and a molecular weight of 319.19 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-quinoxalin-5-ylethanol.
| Compound Name | 2-(2,4-dichlorophenyl)-1-quinoxalin-5-ylethanol |
|---|---|
| PubChem CID | 105086789 |
| Molecular Formula | C16H12Cl2N2O |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-quinoxalin-5-ylethanol |
| SMILES | OC(Cc1ccc(Cl)cc1Cl)c1cccc2nccnc12 |
| InChI | InChI=1S/C16H12Cl2N2O/c17-11-5-4-10(13(18)9-11)8-15(21)12-2-1-3-14-16(12)20-7-6-19-14/h1-7,9,15,21H,8H2 |
| InChIKey | QRNIGJYMLNQBIR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |