C14H10Cl4O — CID 55187922
1-(2,3-dichlorophenyl)-2-(2,4-dichlorophenyl)ethanol (PubChem CID 55187922) has the molecular formula C14H10Cl4O and a molecular weight of 336.05 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-2-(2,4-dichlorophenyl)ethanol.
| Compound Name | 1-(2,3-dichlorophenyl)-2-(2,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 55187922 |
| Molecular Formula | C14H10Cl4O |
| Molecular Weight | 336.05 g/mol |
| Exact Mass | 333.95 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-2-(2,4-dichlorophenyl)ethanol |
| SMILES | OC(Cc1ccc(Cl)cc1Cl)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H10Cl4O/c15-9-5-4-8(12(17)7-9)6-13(19)10-2-1-3-11(16)14(10)18/h1-5,7,13,19H,6H2 |
| InChIKey | JBGLHWOYKXRDDP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.05 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |