C13H17BrN2OS — CID 105090951
2-(3-bromothiophen-2-yl)-1-(1,3-diethylpyrazol-5-yl)ethanol (PubChem CID 105090951) has the molecular formula C13H17BrN2OS and a molecular weight of 329.26 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-1-(1,3-diethylpyrazol-5-yl)ethanol.
| Compound Name | 2-(3-bromothiophen-2-yl)-1-(1,3-diethylpyrazol-5-yl)ethanol |
|---|---|
| PubChem CID | 105090951 |
| Molecular Formula | C13H17BrN2OS |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-1-(1,3-diethylpyrazol-5-yl)ethanol |
| SMILES | CCc1cc(C(O)Cc2sccc2Br)n(CC)n1 |
| InChI | InChI=1S/C13H17BrN2OS/c1-3-9-7-11(16(4-2)15-9)12(17)8-13-10(14)5-6-18-13/h5-7,12,17H,3-4,8H2,1-2H3 |
| InChIKey | OXONMBOBFCLSGW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |