C16H18N2OS — CID 105119200
1-benzothiophen-7-yl-(1,3-diethylpyrazol-5-yl)methanol (PubChem CID 105119200) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is 1-benzothiophen-7-yl-(1,3-diethylpyrazol-5-yl)methanol.
| Compound Name | 1-benzothiophen-7-yl-(1,3-diethylpyrazol-5-yl)methanol |
|---|---|
| PubChem CID | 105119200 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-benzothiophen-7-yl-(1,3-diethylpyrazol-5-yl)methanol |
| SMILES | CCc1cc(C(O)c2cccc3ccsc23)n(CC)n1 |
| InChI | InChI=1S/C16H18N2OS/c1-3-12-10-14(18(4-2)17-12)15(19)13-7-5-6-11-8-9-20-16(11)13/h5-10,15,19H,3-4H2,1-2H3 |
| InChIKey | NZJJTJMUQANZTN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |