C17H19N3O — CID 105094553
(1,3-diethylpyrazol-5-yl)-isoquinolin-5-ylmethanol (PubChem CID 105094553) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is (1,3-diethylpyrazol-5-yl)-isoquinolin-5-ylmethanol.
| Compound Name | (1,3-diethylpyrazol-5-yl)-isoquinolin-5-ylmethanol |
|---|---|
| PubChem CID | 105094553 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (1,3-diethylpyrazol-5-yl)-isoquinolin-5-ylmethanol |
| SMILES | CCc1cc(C(O)c2cccc3cnccc23)n(CC)n1 |
| InChI | InChI=1S/C17H19N3O/c1-3-13-10-16(20(4-2)19-13)17(21)15-7-5-6-12-11-18-9-8-14(12)15/h5-11,17,21H,3-4H2,1-2H3 |
| InChIKey | MZSAGGHTSUUIQL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |