C17H11F2NO — CID 105095171
(3,5-difluorophenyl)-(2-methylquinolin-4-yl)methanone (PubChem CID 105095171) has the molecular formula C17H11F2NO and a molecular weight of 283.28 g/mol. Its IUPAC name is (3,5-difluorophenyl)-(2-methylquinolin-4-yl)methanone.
| Compound Name | (3,5-difluorophenyl)-(2-methylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 105095171 |
| Molecular Formula | C17H11F2NO |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (3,5-difluorophenyl)-(2-methylquinolin-4-yl)methanone |
| SMILES | Cc1cc(C(=O)c2cc(F)cc(F)c2)c2ccccc2n1 |
| InChI | InChI=1S/C17H11F2NO/c1-10-6-15(14-4-2-3-5-16(14)20-10)17(21)11-7-12(18)9-13(19)8-11/h2-9H,1H3 |
| InChIKey | ALUROBVCUICLIZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |