C17H23F3O — CID 105095256
(4-propylphenyl)-[3-(trifluoromethyl)cyclohexyl]methanol (PubChem CID 105095256) has the molecular formula C17H23F3O and a molecular weight of 300.36 g/mol. Its IUPAC name is (4-propylphenyl)-[3-(trifluoromethyl)cyclohexyl]methanol.
| Compound Name | (4-propylphenyl)-[3-(trifluoromethyl)cyclohexyl]methanol |
|---|---|
| PubChem CID | 105095256 |
| Molecular Formula | C17H23F3O |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (4-propylphenyl)-[3-(trifluoromethyl)cyclohexyl]methanol |
| SMILES | CCCc1ccc(C(O)C2CCCC(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C17H23F3O/c1-2-4-12-7-9-13(10-8-12)16(21)14-5-3-6-15(11-14)17(18,19)20/h7-10,14-16,21H,2-6,11H2,1H3 |
| InChIKey | HOIJCKCDJIUQSB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |