C12H16F3NO — CID 112742811
1H-pyrrol-2-yl-[3-(trifluoromethyl)cyclohexyl]methanol (PubChem CID 112742811) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is 1H-pyrrol-2-yl-[3-(trifluoromethyl)cyclohexyl]methanol.
| Compound Name | 1H-pyrrol-2-yl-[3-(trifluoromethyl)cyclohexyl]methanol |
|---|---|
| PubChem CID | 112742811 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 1H-pyrrol-2-yl-[3-(trifluoromethyl)cyclohexyl]methanol |
| SMILES | OC(c1ccc[nH]1)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H16F3NO/c13-12(14,15)9-4-1-3-8(7-9)11(17)10-5-2-6-16-10/h2,5-6,8-9,11,16-17H,1,3-4,7H2 |
| InChIKey | ZQGIMQASKCNJHM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |