C17H24F3N — CID 105187981
(3-propylphenyl)-[3-(trifluoromethyl)cyclohexyl]methanamine (PubChem CID 105187981) has the molecular formula C17H24F3N and a molecular weight of 299.38 g/mol. Its IUPAC name is (3-propylphenyl)-[3-(trifluoromethyl)cyclohexyl]methanamine.
| Compound Name | (3-propylphenyl)-[3-(trifluoromethyl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 105187981 |
| Molecular Formula | C17H24F3N |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (3-propylphenyl)-[3-(trifluoromethyl)cyclohexyl]methanamine |
| SMILES | CCCc1cccc(C(N)C2CCCC(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C17H24F3N/c1-2-5-12-6-3-7-13(10-12)16(21)14-8-4-9-15(11-14)17(18,19)20/h3,6-7,10,14-16H,2,4-5,8-9,11,21H2,1H3 |
| InChIKey | GJRPOLPIRLYEON-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |