C12H16N2OS2 — CID 105099371
1-(4-propylthiadiazol-5-yl)-3-thiophen-2-ylpropan-1-ol (PubChem CID 105099371) has the molecular formula C12H16N2OS2 and a molecular weight of 268.41 g/mol. Its IUPAC name is 1-(4-propylthiadiazol-5-yl)-3-thiophen-2-ylpropan-1-ol.
| Compound Name | 1-(4-propylthiadiazol-5-yl)-3-thiophen-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 105099371 |
| Molecular Formula | C12H16N2OS2 |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 1-(4-propylthiadiazol-5-yl)-3-thiophen-2-ylpropan-1-ol |
| SMILES | CCCc1nnsc1C(O)CCc1cccs1 |
| InChI | InChI=1S/C12H16N2OS2/c1-2-4-10-12(17-14-13-10)11(15)7-6-9-5-3-8-16-9/h3,5,8,11,15H,2,4,6-7H2,1H3 |
| InChIKey | UVVGUMWZEACJBE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |