About (3-bromofuran-2-yl)-(3,6-dimethylpyridazin-4-yl)methanone
(3-bromofuran-2-yl)-(3,6-dimethylpyridazin-4-yl)methanone (PubChem CID 105101644) has the molecular formula C11H9BrN2O2
and a molecular weight of 281.11 g/mol. Its IUPAC name is (3-bromofuran-2-yl)-(3,6-dimethylpyridazin-4-yl)methanone.
Molecular Properties
| Compound Name | (3-bromofuran-2-yl)-(3,6-dimethylpyridazin-4-yl)methanone |
| PubChem CID | 105101644 |
| Molecular Formula | C11H9BrN2O2 |
| Molecular Weight | 281.11 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | (3-bromofuran-2-yl)-(3,6-dimethylpyridazin-4-yl)methanone |
| SMILES | Cc1cc(C(=O)c2occc2Br)c(C)nn1 |
| InChI | InChI=1S/C11H9BrN2O2/c1-6-5-8(7(2)14-13-6)10(15)11-9(12)3-4-16-11/h3-5H,1-2H3 |
| InChIKey | FCIXIEYBJGVXOJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.11 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-bromofuran-2-yl)-(3,6-dimethylpyridazin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromofuran-2-yl)-(3,6-dimethylpyridazin-4-yl)methanone?
The IUPAC name of (3-bromofuran-2-yl)-(3,6-dimethylpyridazin-4-yl)methanone (CID 105101644) is (3-bromofuran-2-yl)-(3,6-dimethylpyridazin-4-yl)methanone.
What is the SMILES notation for (3-bromofuran-2-yl)-(3,6-dimethylpyridazin-4-yl)methanone?
The canonical SMILES for (3-bromofuran-2-yl)-(3,6-dimethylpyridazin-4-yl)methanone is Cc1cc(C(=O)c2occc2Br)c(C)nn1.
What is the InChIKey of (3-bromofuran-2-yl)-(3,6-dimethylpyridazin-4-yl)methanone?
The InChIKey is FCIXIEYBJGVXOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrN2O2/c1-6-5-8(7(2)14-13-6)10(15)11-9(12)3-4-16-11/h3-5H,1-2H3.
What are the key properties of (3-bromofuran-2-yl)-(3,6-dimethylpyridazin-4-yl)methanone?
(3-bromofuran-2-yl)-(3,6-dimethylpyridazin-4-yl)methanone has a molecular weight of 281.11 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromofuran-2-yl)-(3,6-dimethylpyridazin-4-yl)methanone is sourced from PubChem (CID 105101644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).