C12H18N2O — CID 105104474
1-(1,3,5-trimethylpyrazol-4-yl)hex-5-en-2-one (PubChem CID 105104474) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-(1,3,5-trimethylpyrazol-4-yl)hex-5-en-2-one.
| Compound Name | 1-(1,3,5-trimethylpyrazol-4-yl)hex-5-en-2-one |
|---|---|
| PubChem CID | 105104474 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1-(1,3,5-trimethylpyrazol-4-yl)hex-5-en-2-one |
| SMILES | C=CCCC(=O)Cc1c(C)nn(C)c1C |
| InChI | InChI=1S/C12H18N2O/c1-5-6-7-11(15)8-12-9(2)13-14(4)10(12)3/h5H,1,6-8H2,2-4H3 |
| InChIKey | VWFPHPVIPREGRG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|