C11H16N2O — CID 105083092
1-(1,3,5-trimethylpyrazol-4-yl)pent-4-en-2-one (PubChem CID 105083092) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-(1,3,5-trimethylpyrazol-4-yl)pent-4-en-2-one.
| Compound Name | 1-(1,3,5-trimethylpyrazol-4-yl)pent-4-en-2-one |
|---|---|
| PubChem CID | 105083092 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-(1,3,5-trimethylpyrazol-4-yl)pent-4-en-2-one |
| SMILES | C=CCC(=O)Cc1c(C)nn(C)c1C |
| InChI | InChI=1S/C11H16N2O/c1-5-6-10(14)7-11-8(2)12-13(4)9(11)3/h5H,1,6-7H2,2-4H3 |
| InChIKey | QULAMGIIARTDES-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|