C9H15F3O3S — CID 105104651
1-(1,1-dioxothiolan-3-yl)-5,5,5-trifluoropentan-2-ol (PubChem CID 105104651) has the molecular formula C9H15F3O3S and a molecular weight of 260.28 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-5,5,5-trifluoropentan-2-ol.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-5,5,5-trifluoropentan-2-ol |
|---|---|
| PubChem CID | 105104651 |
| Molecular Formula | C9H15F3O3S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-5,5,5-trifluoropentan-2-ol |
| SMILES | O=S1(=O)CCC(CC(O)CCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H15F3O3S/c10-9(11,12)3-1-8(13)5-7-2-4-16(14,15)6-7/h7-8,13H,1-6H2 |
| InChIKey | YPIHNBDFEMJHBH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |