C7H12F2O3S — CID 105467500
3-(1,1-dioxothiolan-3-yl)-2,2-difluoropropan-1-ol (PubChem CID 105467500) has the molecular formula C7H12F2O3S and a molecular weight of 214.23 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-2,2-difluoropropan-1-ol.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 105467500 |
| Molecular Formula | C7H12F2O3S |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-2,2-difluoropropan-1-ol |
| SMILES | O=S1(=O)CCC(CC(F)(F)CO)C1 |
| InChI | InChI=1S/C7H12F2O3S/c8-7(9,5-10)3-6-1-2-13(11,12)4-6/h6,10H,1-5H2 |
| InChIKey | FSKOPJXSAWCFPT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |