About 5-nitrofuro[3,2-b]pyridine
5-nitrofuro[3,2-b]pyridine (PubChem CID 10511213) has the molecular formula C7H4N2O3
and a molecular weight of 164.12 g/mol. Its IUPAC name is 5-nitrofuro[3,2-b]pyridine.
Molecular Properties
| Compound Name | 5-nitrofuro[3,2-b]pyridine |
| PubChem CID | 10511213 |
| Molecular Formula | C7H4N2O3 |
| Molecular Weight | 164.12 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | 5-nitrofuro[3,2-b]pyridine |
| SMILES | O=[N+]([O-])c1ccc2occc2n1 |
| InChI | InChI=1S/C7H4N2O3/c10-9(11)7-2-1-6-5(8-7)3-4-12-6/h1-4H |
| InChIKey | XCEOLAJTOQFBFF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.12 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitrofuro[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitrofuro[3,2-b]pyridine?
The IUPAC name of 5-nitrofuro[3,2-b]pyridine (CID 10511213) is 5-nitrofuro[3,2-b]pyridine.
What is the SMILES notation for 5-nitrofuro[3,2-b]pyridine?
The canonical SMILES for 5-nitrofuro[3,2-b]pyridine is O=[N+]([O-])c1ccc2occc2n1.
What is the InChIKey of 5-nitrofuro[3,2-b]pyridine?
The InChIKey is XCEOLAJTOQFBFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O3/c10-9(11)7-2-1-6-5(8-7)3-4-12-6/h1-4H.
What are the key properties of 5-nitrofuro[3,2-b]pyridine?
5-nitrofuro[3,2-b]pyridine has a molecular weight of 164.12 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitrofuro[3,2-b]pyridine is sourced from PubChem (CID 10511213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).