About 5-nitro-[1,3]dioxolo[4,5-b]pyridine
5-nitro-[1,3]dioxolo[4,5-b]pyridine (PubChem CID 131206454) has the molecular formula C6H4N2O4
and a molecular weight of 168.11 g/mol. Its IUPAC name is 5-nitro-[1,3]dioxolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 5-nitro-[1,3]dioxolo[4,5-b]pyridine |
| PubChem CID | 131206454 |
| Molecular Formula | C6H4N2O4 |
| Molecular Weight | 168.11 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 5-nitro-[1,3]dioxolo[4,5-b]pyridine |
| SMILES | O=[N+]([O-])c1ccc2c(n1)OCO2 |
| InChI | InChI=1S/C6H4N2O4/c9-8(10)5-2-1-4-6(7-5)12-3-11-4/h1-2H,3H2 |
| InChIKey | KIIRUKFQOVIJNK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.11 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-[1,3]dioxolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-[1,3]dioxolo[4,5-b]pyridine?
The IUPAC name of 5-nitro-[1,3]dioxolo[4,5-b]pyridine (CID 131206454) is 5-nitro-[1,3]dioxolo[4,5-b]pyridine.
What is the SMILES notation for 5-nitro-[1,3]dioxolo[4,5-b]pyridine?
The canonical SMILES for 5-nitro-[1,3]dioxolo[4,5-b]pyridine is O=[N+]([O-])c1ccc2c(n1)OCO2.
What is the InChIKey of 5-nitro-[1,3]dioxolo[4,5-b]pyridine?
The InChIKey is KIIRUKFQOVIJNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O4/c9-8(10)5-2-1-4-6(7-5)12-3-11-4/h1-2H,3H2.
What are the key properties of 5-nitro-[1,3]dioxolo[4,5-b]pyridine?
5-nitro-[1,3]dioxolo[4,5-b]pyridine has a molecular weight of 168.11 g/mol, XLogP of 0.72, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-[1,3]dioxolo[4,5-b]pyridine is sourced from PubChem (CID 131206454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).