C6H4N2O4 — CID 131206454
5-nitro-[1,3]dioxolo[4,5-b]pyridine (PubChem CID 131206454) has the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. Its IUPAC name is 5-nitro-[1,3]dioxolo[4,5-b]pyridine.
| Compound Name | 5-nitro-[1,3]dioxolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 131206454 |
| Molecular Formula | C6H4N2O4 |
| Molecular Weight | 168.11 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 5-nitro-[1,3]dioxolo[4,5-b]pyridine |
| SMILES | O=[N+]([O-])c1ccc2c(n1)OCO2 |
| InChI | InChI=1S/C6H4N2O4/c9-8(10)5-2-1-4-6(7-5)12-3-11-4/h1-2H,3H2 |
| InChIKey | KIIRUKFQOVIJNK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.11 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|